C13H14N4O3 — CID 106772640
2-[(1-aminoisoquinoline-4-carbonyl)amino]ethyl carbamate (PubChem CID 106772640) has the molecular formula C13H14N4O3 and a molecular weight of 274.28 g/mol. Its IUPAC name is 2-[(1-aminoisoquinoline-4-carbonyl)amino]ethyl carbamate.
| Compound Name | 2-[(1-aminoisoquinoline-4-carbonyl)amino]ethyl carbamate |
|---|---|
| PubChem CID | 106772640 |
| Molecular Formula | C13H14N4O3 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 2-[(1-aminoisoquinoline-4-carbonyl)amino]ethyl carbamate |
| SMILES | NC(=O)OCCNC(=O)c1cnc(N)c2ccccc12 |
| InChI | InChI=1S/C13H14N4O3/c14-11-9-4-2-1-3-8(9)10(7-17-11)12(18)16-5-6-20-13(15)19/h1-4,7H,5-6H2,(H2,14,17)(H2,15,19)(H,16,18) |
| InChIKey | UTRLDHQFVQLWEK-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 120.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|