C14H12ClN5O — CID 106766221
1-chloro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]isoquinoline-4-carboxamide (PubChem CID 106766221) has the molecular formula C14H12ClN5O and a molecular weight of 301.74 g/mol. Its IUPAC name is 1-chloro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]isoquinoline-4-carboxamide.
| Compound Name | 1-chloro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]isoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 106766221 |
| Molecular Formula | C14H12ClN5O |
| Molecular Weight | 301.74 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 1-chloro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]isoquinoline-4-carboxamide |
| SMILES | O=C(NCCc1ncn[nH]1)c1cnc(Cl)c2ccccc12 |
| InChI | InChI=1S/C14H12ClN5O/c15-13-10-4-2-1-3-9(10)11(7-17-13)14(21)16-6-5-12-18-8-19-20-12/h1-4,7-8H,5-6H2,(H,16,21)(H,18,19,20) |
| InChIKey | DYZHGHDXKANLGB-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.74 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|