C11H10ClN5O3 — CID 115931273
2-chloro-3-nitro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]benzamide (PubChem CID 115931273) has the molecular formula C11H10ClN5O3 and a molecular weight of 295.69 g/mol. Its IUPAC name is 2-chloro-3-nitro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]benzamide.
| Compound Name | 2-chloro-3-nitro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 115931273 |
| Molecular Formula | C11H10ClN5O3 |
| Molecular Weight | 295.69 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | 2-chloro-3-nitro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]benzamide |
| SMILES | O=C(NCCc1ncn[nH]1)c1cccc([N+](=O)[O-])c1Cl |
| InChI | InChI=1S/C11H10ClN5O3/c12-10-7(2-1-3-8(10)17(19)20)11(18)13-5-4-9-14-6-15-16-9/h1-3,6H,4-5H2,(H,13,18)(H,14,15,16) |
| InChIKey | MBVKCMWQOANLIK-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.69 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|