C10H10N6O4 — CID 64547433
5-nitro-2-oxo-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]-1H-pyridine-3-carboxamide (PubChem CID 64547433) has the molecular formula C10H10N6O4 and a molecular weight of 278.23 g/mol. Its IUPAC name is 5-nitro-2-oxo-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]-1H-pyridine-3-carboxamide.
| Compound Name | 5-nitro-2-oxo-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 64547433 |
| Molecular Formula | C10H10N6O4 |
| Molecular Weight | 278.23 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 5-nitro-2-oxo-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]-1H-pyridine-3-carboxamide |
| SMILES | O=C(NCCc1ncn[nH]1)c1cc([N+](=O)[O-])c[nH]c1=O |
| InChI | InChI=1S/C10H10N6O4/c17-9(11-2-1-8-13-5-14-15-8)7-3-6(16(19)20)4-12-10(7)18/h3-5H,1-2H2,(H,11,17)(H,12,18)(H,13,14,15) |
| InChIKey | NVQHUWUUAAJXAC-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 146.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.23 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|