C8H8N4O5 — CID 60715827
N-(2-amino-2-oxoethyl)-5-nitro-2-oxo-1H-pyridine-3-carboxamide (PubChem CID 60715827) has the molecular formula C8H8N4O5 and a molecular weight of 240.17 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-5-nitro-2-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-(2-amino-2-oxoethyl)-5-nitro-2-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 60715827 |
| Molecular Formula | C8H8N4O5 |
| Molecular Weight | 240.17 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-5-nitro-2-oxo-1H-pyridine-3-carboxamide |
| SMILES | NC(=O)CNC(=O)c1cc([N+](=O)[O-])c[nH]c1=O |
| InChI | InChI=1S/C8H8N4O5/c9-6(13)3-11-8(15)5-1-4(12(16)17)2-10-7(5)14/h1-2H,3H2,(H2,9,13)(H,10,14)(H,11,15) |
| InChIKey | ZNSWQFWRVCRJPU-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 148.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.17 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|