C10H10N4O7 — CID 63715717
(2S)-4-amino-2-[(5-nitro-2-oxo-1H-pyridine-3-carbonyl)amino]-4-oxobutanoic acid (PubChem CID 63715717) has the molecular formula C10H10N4O7 and a molecular weight of 298.21 g/mol. Its IUPAC name is (2S)-4-amino-2-[(5-nitro-2-oxo-1H-pyridine-3-carbonyl)amino]-4-oxobutanoic acid.
| Compound Name | (2S)-4-amino-2-[(5-nitro-2-oxo-1H-pyridine-3-carbonyl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 63715717 |
| Molecular Formula | C10H10N4O7 |
| Molecular Weight | 298.21 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | (2S)-4-amino-2-[(5-nitro-2-oxo-1H-pyridine-3-carbonyl)amino]-4-oxobutanoic acid |
| SMILES | NC(=O)C[C@H](NC(=O)c1cc([N+](=O)[O-])c[nH]c1=O)C(=O)O |
| InChI | InChI=1S/C10H10N4O7/c11-7(15)2-6(10(18)19)13-9(17)5-1-4(14(20)21)3-12-8(5)16/h1,3,6H,2H2,(H2,11,15)(H,12,16)(H,13,17)(H,18,19)/t6-/m0/s1 |
| InChIKey | ZGPVAOPKKXFHJM-LURJTMIESA-N |
| XLogP | -1.66 |
| TPSA | 185.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.21 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|