C13H13N3O8 — CID 151470981
2-[[(1R)-4-amino-1-carboxy-4-oxobutyl]carbamoyl]-5-nitrobenzoic acid (PubChem CID 151470981) has the molecular formula C13H13N3O8 and a molecular weight of 339.26 g/mol. Its IUPAC name is 2-[[(1R)-4-amino-1-carboxy-4-oxobutyl]carbamoyl]-5-nitrobenzoic acid.
| Compound Name | 2-[[(1R)-4-amino-1-carboxy-4-oxobutyl]carbamoyl]-5-nitrobenzoic acid |
|---|---|
| PubChem CID | 151470981 |
| Molecular Formula | C13H13N3O8 |
| Molecular Weight | 339.26 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | 2-[[(1R)-4-amino-1-carboxy-4-oxobutyl]carbamoyl]-5-nitrobenzoic acid |
| SMILES | NC(=O)CC[C@@H](NC(=O)c1ccc([N+](=O)[O-])cc1C(=O)O)C(=O)O |
| InChI | InChI=1S/C13H13N3O8/c14-10(17)4-3-9(13(21)22)15-11(18)7-2-1-6(16(23)24)5-8(7)12(19)20/h1-2,5,9H,3-4H2,(H2,14,17)(H,15,18)(H,19,20)(H,21,22)/t9-/m1/s1 |
| InChIKey | PKLOQFWQCAYVQQ-SECBINFHSA-N |
| XLogP | -0.26 |
| TPSA | 189.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.26 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|