C11H10BrN3O6 — CID 107821539
(2R)-4-amino-2-[(2-bromo-5-nitrobenzoyl)amino]-4-oxobutanoic acid (PubChem CID 107821539) has the molecular formula C11H10BrN3O6 and a molecular weight of 360.12 g/mol. Its IUPAC name is (2R)-4-amino-2-[(2-bromo-5-nitrobenzoyl)amino]-4-oxobutanoic acid.
| Compound Name | (2R)-4-amino-2-[(2-bromo-5-nitrobenzoyl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 107821539 |
| Molecular Formula | C11H10BrN3O6 |
| Molecular Weight | 360.12 g/mol |
| Exact Mass | 358.98 |
| IUPAC Name | (2R)-4-amino-2-[(2-bromo-5-nitrobenzoyl)amino]-4-oxobutanoic acid |
| SMILES | NC(=O)C[C@@H](NC(=O)c1cc([N+](=O)[O-])ccc1Br)C(=O)O |
| InChI | InChI=1S/C11H10BrN3O6/c12-7-2-1-5(15(20)21)3-6(7)10(17)14-8(11(18)19)4-9(13)16/h1-3,8H,4H2,(H2,13,16)(H,14,17)(H,18,19)/t8-/m1/s1 |
| InChIKey | YDKFECLIPJBMKU-MRVPVSSYSA-N |
| XLogP | 0.42 |
| TPSA | 152.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.12 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|