C10H9BrN2O5 — CID 78979087
(2R)-2-[(2-bromo-5-nitrobenzoyl)amino]propanoic acid (PubChem CID 78979087) has the molecular formula C10H9BrN2O5 and a molecular weight of 317.10 g/mol. Its IUPAC name is (2R)-2-[(2-bromo-5-nitrobenzoyl)amino]propanoic acid.
| Compound Name | (2R)-2-[(2-bromo-5-nitrobenzoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 78979087 |
| Molecular Formula | C10H9BrN2O5 |
| Molecular Weight | 317.10 g/mol |
| Exact Mass | 315.97 |
| IUPAC Name | (2R)-2-[(2-bromo-5-nitrobenzoyl)amino]propanoic acid |
| SMILES | C[C@@H](NC(=O)c1cc([N+](=O)[O-])ccc1Br)C(=O)O |
| InChI | InChI=1S/C10H9BrN2O5/c1-5(10(15)16)12-9(14)7-4-6(13(17)18)2-3-8(7)11/h2-5H,1H3,(H,12,14)(H,15,16)/t5-/m1/s1 |
| InChIKey | SXYLOVREZBOBSY-RXMQYKEDSA-N |
| XLogP | 1.56 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.10 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|