C12H14N2O6 — CID 107829776
(2R)-5-amino-2-[(2,3-dihydroxybenzoyl)amino]-5-oxopentanoic acid (PubChem CID 107829776) has the molecular formula C12H14N2O6 and a molecular weight of 282.25 g/mol. Its IUPAC name is (2R)-5-amino-2-[(2,3-dihydroxybenzoyl)amino]-5-oxopentanoic acid.
| Compound Name | (2R)-5-amino-2-[(2,3-dihydroxybenzoyl)amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 107829776 |
| Molecular Formula | C12H14N2O6 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | (2R)-5-amino-2-[(2,3-dihydroxybenzoyl)amino]-5-oxopentanoic acid |
| SMILES | NC(=O)CC[C@@H](NC(=O)c1cccc(O)c1O)C(=O)O |
| InChI | InChI=1S/C12H14N2O6/c13-9(16)5-4-7(12(19)20)14-11(18)6-2-1-3-8(15)10(6)17/h1-3,7,15,17H,4-5H2,(H2,13,16)(H,14,18)(H,19,20)/t7-/m1/s1 |
| InChIKey | UTUXZZILNDDGGJ-SSDOTTSWSA-N |
| XLogP | -0.45 |
| TPSA | 149.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|