C10H11NO6 — CID 656417
2-[(2,3-dihydroxybenzoyl)amino]-3-hydroxypropanoic acid (PubChem CID 656417) has the molecular formula C10H11NO6 and a molecular weight of 241.20 g/mol. Its IUPAC name is 2-[(2,3-dihydroxybenzoyl)amino]-3-hydroxypropanoic acid.
| Compound Name | 2-[(2,3-dihydroxybenzoyl)amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 656417 |
| Molecular Formula | C10H11NO6 |
| Molecular Weight | 241.20 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | 2-[(2,3-dihydroxybenzoyl)amino]-3-hydroxypropanoic acid |
| SMILES | O=C(NC(CO)C(=O)O)c1cccc(O)c1O |
| InChI | InChI=1S/C10H11NO6/c12-4-6(10(16)17)11-9(15)5-2-1-3-7(13)8(5)14/h1-3,6,12-14H,4H2,(H,11,15)(H,16,17) |
| InChIKey | VDTYHTVHFIIEIL-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.20 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|