C11H11NO6 — CID 3043783
(2S)-2-[(2-hydroxybenzoyl)amino]butanedioic acid (PubChem CID 3043783) has the molecular formula C11H11NO6 and a molecular weight of 253.21 g/mol. Its IUPAC name is (2S)-2-[(2-hydroxybenzoyl)amino]butanedioic acid.
| Compound Name | (2S)-2-[(2-hydroxybenzoyl)amino]butanedioic acid |
|---|---|
| PubChem CID | 3043783 |
| Molecular Formula | C11H11NO6 |
| Molecular Weight | 253.21 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | (2S)-2-[(2-hydroxybenzoyl)amino]butanedioic acid |
| SMILES | O=C(O)C[C@H](NC(=O)c1ccccc1O)C(=O)O |
| InChI | InChI=1S/C11H11NO6/c13-8-4-2-1-3-6(8)10(16)12-7(11(17)18)5-9(14)15/h1-4,7,13H,5H2,(H,12,16)(H,14,15)(H,17,18)/t7-/m0/s1 |
| InChIKey | JMJWCANHASMNST-ZETCQYMHSA-N |
| XLogP | 0.05 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.21 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |