C10H9ClN2O5 — CID 103602693
2-[(2-chloropyridine-3-carbonyl)amino]butanedioic acid (PubChem CID 103602693) has the molecular formula C10H9ClN2O5 and a molecular weight of 272.64 g/mol. Its IUPAC name is 2-[(2-chloropyridine-3-carbonyl)amino]butanedioic acid.
| Compound Name | 2-[(2-chloropyridine-3-carbonyl)amino]butanedioic acid |
|---|---|
| PubChem CID | 103602693 |
| Molecular Formula | C10H9ClN2O5 |
| Molecular Weight | 272.64 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | 2-[(2-chloropyridine-3-carbonyl)amino]butanedioic acid |
| SMILES | O=C(O)CC(NC(=O)c1cccnc1Cl)C(=O)O |
| InChI | InChI=1S/C10H9ClN2O5/c11-8-5(2-1-3-12-8)9(16)13-6(10(17)18)4-7(14)15/h1-3,6H,4H2,(H,13,16)(H,14,15)(H,17,18) |
| InChIKey | OPNZEZOMRPEOND-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 116.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.64 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|