C22H18ClN3O4 — CID 20711842
(2S)-2-benzamido-3-[4-[(2-chloropyridine-3-carbonyl)amino]phenyl]propanoic acid (PubChem CID 20711842) has the molecular formula C22H18ClN3O4 and a molecular weight of 423.86 g/mol. Its IUPAC name is (2S)-2-benzamido-3-[4-[(2-chloropyridine-3-carbonyl)amino]phenyl]propanoic acid.
| Compound Name | (2S)-2-benzamido-3-[4-[(2-chloropyridine-3-carbonyl)amino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 20711842 |
| Molecular Formula | C22H18ClN3O4 |
| Molecular Weight | 423.86 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | (2S)-2-benzamido-3-[4-[(2-chloropyridine-3-carbonyl)amino]phenyl]propanoic acid |
| SMILES | O=C(N[C@@H](Cc1ccc(NC(=O)c2cccnc2Cl)cc1)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C22H18ClN3O4/c23-19-17(7-4-12-24-19)21(28)25-16-10-8-14(9-11-16)13-18(22(29)30)26-20(27)15-5-2-1-3-6-15/h1-12,18H,13H2,(H,25,28)(H,26,27)(H,29,30)/t18-/m0/s1 |
| InChIKey | SCCDVBZZOATJID-SFHVURJKSA-N |
| XLogP | 3.41 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.86 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|