C20H21Cl2N3O5 — CID 143106551
3-[4-[(2,3-dichloropyridine-4-carbonyl)amino]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (PubChem CID 143106551) has the molecular formula C20H21Cl2N3O5 and a molecular weight of 454.31 g/mol. Its IUPAC name is 3-[4-[(2,3-dichloropyridine-4-carbonyl)amino]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.
| Compound Name | 3-[4-[(2,3-dichloropyridine-4-carbonyl)amino]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 143106551 |
| Molecular Formula | C20H21Cl2N3O5 |
| Molecular Weight | 454.31 g/mol |
| Exact Mass | 453.09 |
| IUPAC Name | 3-[4-[(2,3-dichloropyridine-4-carbonyl)amino]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccc(NC(=O)c2ccnc(Cl)c2Cl)cc1)C(=O)O |
| InChI | InChI=1S/C20H21Cl2N3O5/c1-20(2,3)30-19(29)25-14(18(27)28)10-11-4-6-12(7-5-11)24-17(26)13-8-9-23-16(22)15(13)21/h4-9,14H,10H2,1-3H3,(H,24,26)(H,25,29)(H,27,28) |
| InChIKey | WANYLQPMJZRSIE-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 117.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.31 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|