C28H38N2O10Zn — CID 11114823
bis((2S)-3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid);zinc (PubChem CID 11114823) has the molecular formula C28H38N2O10Zn and a molecular weight of 628.01 g/mol. Its IUPAC name is bis((2S)-3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid);zinc.
| Compound Name | bis((2S)-3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid);zinc |
|---|---|
| PubChem CID | 11114823 |
| Molecular Formula | C28H38N2O10Zn |
| Molecular Weight | 628.01 g/mol |
| Exact Mass | 626.18 |
| IUPAC Name | bis((2S)-3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid);zinc |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O.CC(C)(C)OC(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O.[Zn] |
| InChI | InChI=1S/2C14H19NO5.Zn/c2*1-14(2,3)20-13(19)15-11(12(17)18)8-9-4-6-10(16)7-5-9;/h2*4-7,11,16H,8H2,1-3H3,(H,15,19)(H,17,18);/t2*11-;/m00./s1 |
| InChIKey | XTYNOALJVYODMN-ISAZSYCMSA-N |
| XLogP | 3.82 |
| TPSA | 191.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.01 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|