C14H20BNO6 — CID 165413551
3-(4-boronophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino](113C)propanoic acid (PubChem CID 165413551) has the molecular formula C14H20BNO6 and a molecular weight of 310.12 g/mol. Its IUPAC name is 3-(4-boronophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino](113C)propanoic acid.
| Compound Name | 3-(4-boronophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino](113C)propanoic acid |
|---|---|
| PubChem CID | 165413551 |
| Molecular Formula | C14H20BNO6 |
| Molecular Weight | 310.12 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 3-(4-boronophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino](113C)propanoic acid |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccc(B(O)O)cc1)[13C](=O)O |
| InChI | InChI=1S/C14H20BNO6/c1-14(2,3)22-13(19)16-11(12(17)18)8-9-4-6-10(7-5-9)15(20)21/h4-7,11,20-21H,8H2,1-3H3,(H,16,19)(H,17,18)/i12+1 |
| InChIKey | SGRRXMOSJYUMBY-HNHCFKFXSA-N |
| XLogP | -0.11 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.12 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|