C23H22N4O11 — CID 135860177
2-[[2-[4-[[3-(1,2-dicarboxyethylcarbamoyl)-4-hydroxyphenyl]diazenyl]phenyl]acetyl]amino]butanedioic acid (PubChem CID 135860177) has the molecular formula C23H22N4O11 and a molecular weight of 530.45 g/mol. Its IUPAC name is 2-[[2-[4-[[3-(1,2-dicarboxyethylcarbamoyl)-4-hydroxyphenyl]diazenyl]phenyl]acetyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[4-[[3-(1,2-dicarboxyethylcarbamoyl)-4-hydroxyphenyl]diazenyl]phenyl]acetyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 135860177 |
| Molecular Formula | C23H22N4O11 |
| Molecular Weight | 530.45 g/mol |
| Exact Mass | 530.13 |
| IUPAC Name | 2-[[2-[4-[[3-(1,2-dicarboxyethylcarbamoyl)-4-hydroxyphenyl]diazenyl]phenyl]acetyl]amino]butanedioic acid |
| SMILES | O=C(O)CC(NC(=O)Cc1ccc(/N=N/c2ccc(O)c(C(=O)NC(CC(=O)O)C(=O)O)c2)cc1)C(=O)O |
| InChI | InChI=1S/C23H22N4O11/c28-17-6-5-13(8-14(17)21(34)25-16(23(37)38)10-20(32)33)27-26-12-3-1-11(2-4-12)7-18(29)24-15(22(35)36)9-19(30)31/h1-6,8,15-16,28H,7,9-10H2,(H,24,29)(H,25,34)(H,30,31)(H,32,33)(H,35,36)(H,37,38)/b27-26+ |
| InChIKey | GPAKUXVORJEUHO-CYYJNZCTSA-N |
| XLogP | 1.05 |
| TPSA | 252.35 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.45 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|