C28H22N4O6 — CID 177409080
5-[[4-[2-[4-[(3-carboxy-4-hydroxyphenyl)diazenyl]phenyl]ethyl]phenyl]diazenyl]-2-hydroxybenzoic acid (PubChem CID 177409080) has the molecular formula C28H22N4O6 and a molecular weight of 510.51 g/mol. Its IUPAC name is 5-[[4-[2-[4-[(3-carboxy-4-hydroxyphenyl)diazenyl]phenyl]ethyl]phenyl]diazenyl]-2-hydroxybenzoic acid.
| Compound Name | 5-[[4-[2-[4-[(3-carboxy-4-hydroxyphenyl)diazenyl]phenyl]ethyl]phenyl]diazenyl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 177409080 |
| Molecular Formula | C28H22N4O6 |
| Molecular Weight | 510.51 g/mol |
| Exact Mass | 510.15 |
| IUPAC Name | 5-[[4-[2-[4-[(3-carboxy-4-hydroxyphenyl)diazenyl]phenyl]ethyl]phenyl]diazenyl]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1cc(/N=N/c2ccc(CCc3ccc(/N=N/c4ccc(O)c(C(=O)O)c4)cc3)cc2)ccc1O |
| InChI | InChI=1S/C28H22N4O6/c33-25-13-11-21(15-23(25)27(35)36)31-29-19-7-3-17(4-8-19)1-2-18-5-9-20(10-6-18)30-32-22-12-14-26(34)24(16-22)28(37)38/h3-16,33-34H,1-2H2,(H,35,36)(H,37,38)/b31-29+,32-30+ |
| InChIKey | HGHKUWJJQONZKE-JWTBXLROSA-N |
| XLogP | 7.11 |
| TPSA | 164.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.51 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|