C13H9N3O5 — CID 154698524
5-[(3-carboxy-4-hydroxyphenyl)diazenyl]pyridine-3-carboxylic acid (PubChem CID 154698524) has the molecular formula C13H9N3O5 and a molecular weight of 287.23 g/mol. Its IUPAC name is 5-[(3-carboxy-4-hydroxyphenyl)diazenyl]pyridine-3-carboxylic acid.
| Compound Name | 5-[(3-carboxy-4-hydroxyphenyl)diazenyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 154698524 |
| Molecular Formula | C13H9N3O5 |
| Molecular Weight | 287.23 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 5-[(3-carboxy-4-hydroxyphenyl)diazenyl]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cncc(/N=N/c2ccc(O)c(C(=O)O)c2)c1 |
| InChI | InChI=1S/C13H9N3O5/c17-11-2-1-8(4-10(11)13(20)21)15-16-9-3-7(12(18)19)5-14-6-9/h1-6,17H,(H,18,19)(H,20,21)/b16-15+ |
| InChIKey | LRBJTNPAFMTUIG-FOCLMDBBSA-N |
| XLogP | 2.60 |
| TPSA | 132.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.23 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|