C14H12N2O7S — CID 136736042
2-hydroxy-5-[(4-methoxy-3-sulfophenyl)diazenyl]benzoic acid (PubChem CID 136736042) has the molecular formula C14H12N2O7S and a molecular weight of 352.32 g/mol. Its IUPAC name is 2-hydroxy-5-[(4-methoxy-3-sulfophenyl)diazenyl]benzoic acid.
| Compound Name | 2-hydroxy-5-[(4-methoxy-3-sulfophenyl)diazenyl]benzoic acid |
|---|---|
| PubChem CID | 136736042 |
| Molecular Formula | C14H12N2O7S |
| Molecular Weight | 352.32 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | 2-hydroxy-5-[(4-methoxy-3-sulfophenyl)diazenyl]benzoic acid |
| SMILES | COc1ccc(/N=N/c2ccc(O)c(C(=O)O)c2)cc1S(=O)(=O)O |
| InChI | InChI=1S/C14H12N2O7S/c1-23-12-5-3-9(7-13(12)24(20,21)22)16-15-8-2-4-11(17)10(6-8)14(18)19/h2-7,17H,1H3,(H,18,19)(H,20,21,22)/b16-15+ |
| InChIKey | WWWDIHMESOBJCX-FOCLMDBBSA-N |
| XLogP | 2.76 |
| TPSA | 145.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.32 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|