C13H9N2O6S- — CID 3746741
4-[(3-carboxy-4-hydroxyphenyl)diazenyl]benzenesulfonate (PubChem CID 3746741) has the molecular formula C13H9N2O6S- and a molecular weight of 321.29 g/mol. Its IUPAC name is 4-[(3-carboxy-4-hydroxyphenyl)diazenyl]benzenesulfonate.
| Compound Name | 4-[(3-carboxy-4-hydroxyphenyl)diazenyl]benzenesulfonate |
|---|---|
| PubChem CID | 3746741 |
| Molecular Formula | C13H9N2O6S- |
| Molecular Weight | 321.29 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | 4-[(3-carboxy-4-hydroxyphenyl)diazenyl]benzenesulfonate |
| SMILES | O=C(O)c1cc(/N=N/c2ccc(S(=O)(=O)[O-])cc2)ccc1O |
| InChI | InChI=1S/C13H10N2O6S/c16-12-6-3-9(7-11(12)13(17)18)15-14-8-1-4-10(5-2-8)22(19,20)21/h1-7,16H,(H,17,18)(H,19,20,21)/p-1/b15-14+ |
| InChIKey | MXCDRFGKHNFKIP-CCEZHUSRSA-M |
| XLogP | 2.41 |
| TPSA | 139.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.29 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|