C15H13N3O5S — CID 4076883
5-[[4-(ethenylsulfamoyl)phenyl]diazenyl]-2-hydroxybenzoic acid (PubChem CID 4076883) has the molecular formula C15H13N3O5S and a molecular weight of 347.35 g/mol. Its IUPAC name is 5-[[4-(ethenylsulfamoyl)phenyl]diazenyl]-2-hydroxybenzoic acid.
| Compound Name | 5-[[4-(ethenylsulfamoyl)phenyl]diazenyl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 4076883 |
| Molecular Formula | C15H13N3O5S |
| Molecular Weight | 347.35 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 5-[[4-(ethenylsulfamoyl)phenyl]diazenyl]-2-hydroxybenzoic acid |
| SMILES | C=CNS(=O)(=O)c1ccc(/N=N/c2ccc(O)c(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C15H13N3O5S/c1-2-16-24(22,23)12-6-3-10(4-7-12)17-18-11-5-8-14(19)13(9-11)15(20)21/h2-9,16,19H,1H2,(H,20,21)/b18-17+ |
| InChIKey | BJFMWDQFKYLHQJ-ISLYRVAYSA-N |
| XLogP | 2.93 |
| TPSA | 128.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|