C20H18N4O4S — CID 167078695
4-[(4-hydroxy-3-propanoylphenyl)diazenyl]-N-pyridin-2-ylbenzenesulfonamide (PubChem CID 167078695) has the molecular formula C20H18N4O4S and a molecular weight of 410.46 g/mol. Its IUPAC name is 4-[(4-hydroxy-3-propanoylphenyl)diazenyl]-N-pyridin-2-ylbenzenesulfonamide.
| Compound Name | 4-[(4-hydroxy-3-propanoylphenyl)diazenyl]-N-pyridin-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 167078695 |
| Molecular Formula | C20H18N4O4S |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 4-[(4-hydroxy-3-propanoylphenyl)diazenyl]-N-pyridin-2-ylbenzenesulfonamide |
| SMILES | CCC(=O)c1cc(/N=N/c2ccc(S(=O)(=O)Nc3ccccn3)cc2)ccc1O |
| InChI | InChI=1S/C20H18N4O4S/c1-2-18(25)17-13-15(8-11-19(17)26)23-22-14-6-9-16(10-7-14)29(27,28)24-20-5-3-4-12-21-20/h3-13,26H,2H2,1H3,(H,21,24)/b23-22+ |
| InChIKey | KRPLYIILYPOLRI-GHVJWSGMSA-N |
| XLogP | 4.60 |
| TPSA | 121.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|