C24H23N5O6S — CID 154966023
[2-(cyclopropylmethylamino)-2-oxoethyl] 2-hydroxy-5-[[4-(pyridin-2-ylsulfamoyl)phenyl]diazenyl]benzoate (PubChem CID 154966023) has the molecular formula C24H23N5O6S and a molecular weight of 509.54 g/mol. Its IUPAC name is [2-(cyclopropylmethylamino)-2-oxoethyl] 2-hydroxy-5-[[4-(pyridin-2-ylsulfamoyl)phenyl]diazenyl]benzoate.
| Compound Name | [2-(cyclopropylmethylamino)-2-oxoethyl] 2-hydroxy-5-[[4-(pyridin-2-ylsulfamoyl)phenyl]diazenyl]benzoate |
|---|---|
| PubChem CID | 154966023 |
| Molecular Formula | C24H23N5O6S |
| Molecular Weight | 509.54 g/mol |
| Exact Mass | 509.14 |
| IUPAC Name | [2-(cyclopropylmethylamino)-2-oxoethyl] 2-hydroxy-5-[[4-(pyridin-2-ylsulfamoyl)phenyl]diazenyl]benzoate |
| SMILES | O=C(COC(=O)c1cc(/N=N/c2ccc(S(=O)(=O)Nc3ccccn3)cc2)ccc1O)NCC1CC1 |
| InChI | InChI=1S/C24H23N5O6S/c30-21-11-8-18(13-20(21)24(32)35-15-23(31)26-14-16-4-5-16)28-27-17-6-9-19(10-7-17)36(33,34)29-22-3-1-2-12-25-22/h1-3,6-13,16,30H,4-5,14-15H2,(H,25,29)(H,26,31)/b28-27+ |
| InChIKey | ZTDXSIMGCYOQGO-BYYHNAKLSA-N |
| XLogP | 3.69 |
| TPSA | 159.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.54 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|