C20H20N4O3S — CID 72735611
4-[(4-methoxy-3,5-dimethylphenyl)diazenyl]-N-pyridin-2-ylbenzenesulfonamide (PubChem CID 72735611) has the molecular formula C20H20N4O3S and a molecular weight of 396.47 g/mol. Its IUPAC name is 4-[(4-methoxy-3,5-dimethylphenyl)diazenyl]-N-pyridin-2-ylbenzenesulfonamide.
| Compound Name | 4-[(4-methoxy-3,5-dimethylphenyl)diazenyl]-N-pyridin-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 72735611 |
| Molecular Formula | C20H20N4O3S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 4-[(4-methoxy-3,5-dimethylphenyl)diazenyl]-N-pyridin-2-ylbenzenesulfonamide |
| SMILES | COc1c(C)cc(/N=N/c2ccc(S(=O)(=O)Nc3ccccn3)cc2)cc1C |
| InChI | InChI=1S/C20H20N4O3S/c1-14-12-17(13-15(2)20(14)27-3)23-22-16-7-9-18(10-8-16)28(25,26)24-19-6-4-5-11-21-19/h4-13H,1-3H3,(H,21,24)/b23-22+ |
| InChIKey | XSXTVZGIXAQCCK-GHVJWSGMSA-N |
| XLogP | 4.92 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|