C12H11ClN2O3S — CID 674105
4-chloro-3-methoxy-N-pyridin-2-ylbenzenesulfonamide (PubChem CID 674105) has the molecular formula C12H11ClN2O3S and a molecular weight of 298.75 g/mol. Its IUPAC name is 4-chloro-3-methoxy-N-pyridin-2-ylbenzenesulfonamide.
| Compound Name | 4-chloro-3-methoxy-N-pyridin-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 674105 |
| Molecular Formula | C12H11ClN2O3S |
| Molecular Weight | 298.75 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | 4-chloro-3-methoxy-N-pyridin-2-ylbenzenesulfonamide |
| SMILES | COc1cc(S(=O)(=O)Nc2ccccn2)ccc1Cl |
| InChI | InChI=1S/C12H11ClN2O3S/c1-18-11-8-9(5-6-10(11)13)19(16,17)15-12-4-2-3-7-14-12/h2-8H,1H3,(H,14,15) |
| InChIKey | YDFWVQDTODNHNL-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.75 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |