C18H16BrN3O5S2 — CID 25048503
5-bromo-2-methoxy-N-[4-(pyridin-2-ylsulfamoyl)phenyl]benzenesulfonamide (PubChem CID 25048503) has the molecular formula C18H16BrN3O5S2 and a molecular weight of 498.38 g/mol. Its IUPAC name is 5-bromo-2-methoxy-N-[4-(pyridin-2-ylsulfamoyl)phenyl]benzenesulfonamide.
| Compound Name | 5-bromo-2-methoxy-N-[4-(pyridin-2-ylsulfamoyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 25048503 |
| Molecular Formula | C18H16BrN3O5S2 |
| Molecular Weight | 498.38 g/mol |
| Exact Mass | 496.97 |
| IUPAC Name | 5-bromo-2-methoxy-N-[4-(pyridin-2-ylsulfamoyl)phenyl]benzenesulfonamide |
| SMILES | COc1ccc(Br)cc1S(=O)(=O)Nc1ccc(S(=O)(=O)Nc2ccccn2)cc1 |
| InChI | InChI=1S/C18H16BrN3O5S2/c1-27-16-10-5-13(19)12-17(16)29(25,26)21-14-6-8-15(9-7-14)28(23,24)22-18-4-2-3-11-20-18/h2-12,21H,1H3,(H,20,22) |
| InChIKey | QZZCUVHXEFILAW-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 114.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.38 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |