C13H15N3O4S — CID 102945838
5-amino-2,4-dimethoxy-N-pyridin-2-ylbenzenesulfonamide (PubChem CID 102945838) has the molecular formula C13H15N3O4S and a molecular weight of 309.35 g/mol. Its IUPAC name is 5-amino-2,4-dimethoxy-N-pyridin-2-ylbenzenesulfonamide.
| Compound Name | 5-amino-2,4-dimethoxy-N-pyridin-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 102945838 |
| Molecular Formula | C13H15N3O4S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 5-amino-2,4-dimethoxy-N-pyridin-2-ylbenzenesulfonamide |
| SMILES | COc1cc(OC)c(S(=O)(=O)Nc2ccccn2)cc1N |
| InChI | InChI=1S/C13H15N3O4S/c1-19-10-8-11(20-2)12(7-9(10)14)21(17,18)16-13-5-3-4-6-15-13/h3-8H,14H2,1-2H3,(H,15,16) |
| InChIKey | IDKJLPHNJUYEQC-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|