C12H14N2O4S2 — CID 102946035
5-amino-2,4-dimethoxy-N-thiophen-3-ylbenzenesulfonamide (PubChem CID 102946035) has the molecular formula C12H14N2O4S2 and a molecular weight of 314.39 g/mol. Its IUPAC name is 5-amino-2,4-dimethoxy-N-thiophen-3-ylbenzenesulfonamide.
| Compound Name | 5-amino-2,4-dimethoxy-N-thiophen-3-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 102946035 |
| Molecular Formula | C12H14N2O4S2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | 5-amino-2,4-dimethoxy-N-thiophen-3-ylbenzenesulfonamide |
| SMILES | COc1cc(OC)c(S(=O)(=O)Nc2ccsc2)cc1N |
| InChI | InChI=1S/C12H14N2O4S2/c1-17-10-6-11(18-2)12(5-9(10)13)20(15,16)14-8-3-4-19-7-8/h3-7,14H,13H2,1-2H3 |
| InChIKey | WFJDWIKKDOCBDX-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|