C18H14F3N5O6S3 — CID 139507027
2-[[4-[[2-[[difluoro(oxo)-λ6-sulfanylidene]amino]-4-fluorosulfonyloxy-5-methylphenyl]diazenyl]phenyl]sulfonylamino]pyridine (PubChem CID 139507027) has the molecular formula C18H14F3N5O6S3 and a molecular weight of 549.53 g/mol. Its IUPAC name is 2-[[4-[[2-[[difluoro(oxo)-λ6-sulfanylidene]amino]-4-fluorosulfonyloxy-5-methylphenyl]diazenyl]phenyl]sulfonylamino]pyridine.
| Compound Name | 2-[[4-[[2-[[difluoro(oxo)-λ6-sulfanylidene]amino]-4-fluorosulfonyloxy-5-methylphenyl]diazenyl]phenyl]sulfonylamino]pyridine |
|---|---|
| PubChem CID | 139507027 |
| Molecular Formula | C18H14F3N5O6S3 |
| Molecular Weight | 549.53 g/mol |
| Exact Mass | 549.01 |
| IUPAC Name | 2-[[4-[[2-[[difluoro(oxo)-λ6-sulfanylidene]amino]-4-fluorosulfonyloxy-5-methylphenyl]diazenyl]phenyl]sulfonylamino]pyridine |
| SMILES | Cc1cc(/N=N/c2ccc(S(=O)(=O)Nc3ccccn3)cc2)c(N=S(=O)(F)F)cc1OS(=O)(=O)F |
| InChI | InChI=1S/C18H14F3N5O6S3/c1-12-10-15(16(25-34(19,20)29)11-17(12)32-35(21,30)31)24-23-13-5-7-14(8-6-13)33(27,28)26-18-4-2-3-9-22-18/h2-11H,1H3,(H,22,26)/b24-23+ |
| InChIKey | OXCWLDOSRCFWHP-WCWDXBQESA-N |
| XLogP | 5.07 |
| TPSA | 156.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.53 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|