C18H14N4O8S2 — CID 170455182
5-[[4-(pyridin-2-ylsulfamoyl)phenyl]diazenyl]-2-sulfooxybenzoic acid (PubChem CID 170455182) has the molecular formula C18H14N4O8S2 and a molecular weight of 478.46 g/mol. Its IUPAC name is 5-[[4-(pyridin-2-ylsulfamoyl)phenyl]diazenyl]-2-sulfooxybenzoic acid.
| Compound Name | 5-[[4-(pyridin-2-ylsulfamoyl)phenyl]diazenyl]-2-sulfooxybenzoic acid |
|---|---|
| PubChem CID | 170455182 |
| Molecular Formula | C18H14N4O8S2 |
| Molecular Weight | 478.46 g/mol |
| Exact Mass | 478.03 |
| IUPAC Name | 5-[[4-(pyridin-2-ylsulfamoyl)phenyl]diazenyl]-2-sulfooxybenzoic acid |
| SMILES | O=C(O)c1cc(/N=N/c2ccc(S(=O)(=O)Nc3ccccn3)cc2)ccc1OS(=O)(=O)O |
| InChI | InChI=1S/C18H14N4O8S2/c23-18(24)15-11-13(6-9-16(15)30-32(27,28)29)21-20-12-4-7-14(8-5-12)31(25,26)22-17-3-1-2-10-19-17/h1-11H,(H,19,22)(H,23,24)(H,27,28,29)/b21-20+ |
| InChIKey | MQGXOHHEPYGWHK-QZQOTICOSA-N |
| XLogP | 3.18 |
| TPSA | 184.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.46 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|