C27H23N7O7S3 — CID 174831495
4-amino-N-(1,3-thiazol-2-yl)benzenesulfonamide;2-hydroxy-5-[[4-(pyridin-2-ylsulfamoyl)phenyl]diazenyl]benzoic acid (PubChem CID 174831495) has the molecular formula C27H23N7O7S3 and a molecular weight of 653.72 g/mol. Its IUPAC name is 4-amino-N-(1,3-thiazol-2-yl)benzenesulfonamide;2-hydroxy-5-[[4-(pyridin-2-ylsulfamoyl)phenyl]diazenyl]benzoic acid.
| Compound Name | 4-amino-N-(1,3-thiazol-2-yl)benzenesulfonamide;2-hydroxy-5-[[4-(pyridin-2-ylsulfamoyl)phenyl]diazenyl]benzoic acid |
|---|---|
| PubChem CID | 174831495 |
| Molecular Formula | C27H23N7O7S3 |
| Molecular Weight | 653.72 g/mol |
| Exact Mass | 653.08 |
| IUPAC Name | 4-amino-N-(1,3-thiazol-2-yl)benzenesulfonamide;2-hydroxy-5-[[4-(pyridin-2-ylsulfamoyl)phenyl]diazenyl]benzoic acid |
| SMILES | Nc1ccc(S(=O)(=O)Nc2nccs2)cc1.O=C(O)c1cc(/N=N/c2ccc(S(=O)(=O)Nc3ccccn3)cc2)ccc1O |
| InChI | InChI=1S/C18H14N4O5S.C9H9N3O2S2/c23-16-9-6-13(11-15(16)18(24)25)21-20-12-4-7-14(8-5-12)28(26,27)22-17-3-1-2-10-19-17;10-7-1-3-8(4-2-7)16(13,14)12-9-11-5-6-15-9/h1-11,23H,(H,19,22)(H,24,25);1-6H,10H2,(H,11,12)/b21-20+; |
| InChIKey | CCKHOSWBQXFVQD-ANVLNOONSA-N |
| XLogP | 5.23 |
| TPSA | 226.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.72 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|