C19H15N5O5S3 — CID 171716520
5-amino-8-[[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]diazenyl]naphthalene-2-sulfonic acid (PubChem CID 171716520) has the molecular formula C19H15N5O5S3 and a molecular weight of 489.56 g/mol. Its IUPAC name is 5-amino-8-[[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]diazenyl]naphthalene-2-sulfonic acid.
| Compound Name | 5-amino-8-[[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]diazenyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 171716520 |
| Molecular Formula | C19H15N5O5S3 |
| Molecular Weight | 489.56 g/mol |
| Exact Mass | 489.02 |
| IUPAC Name | 5-amino-8-[[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]diazenyl]naphthalene-2-sulfonic acid |
| SMILES | Nc1ccc(/N=N/c2ccc(S(=O)(=O)Nc3nccs3)cc2)c2cc(S(=O)(=O)O)ccc12 |
| InChI | InChI=1S/C19H15N5O5S3/c20-17-7-8-18(16-11-14(32(27,28)29)5-6-15(16)17)23-22-12-1-3-13(4-2-12)31(25,26)24-19-21-9-10-30-19/h1-11H,20H2,(H,21,24)(H,27,28,29)/b23-22+ |
| InChIKey | JPAXXTLSPPHXQX-GHVJWSGMSA-N |
| XLogP | 4.34 |
| TPSA | 164.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.56 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|