C22H17N4NaO6S2 — CID 101323668
sodium 7-amino-5-[[4-(phenylsulfamoyl)phenyl]diazenyl]-3-sulfonaphthalen-1-olate (PubChem CID 101323668) has the molecular formula C22H17N4NaO6S2 and a molecular weight of 520.52 g/mol. Its IUPAC name is sodium 7-amino-5-[[4-(phenylsulfamoyl)phenyl]diazenyl]-3-sulfonaphthalen-1-olate.
| Compound Name | sodium 7-amino-5-[[4-(phenylsulfamoyl)phenyl]diazenyl]-3-sulfonaphthalen-1-olate |
|---|---|
| PubChem CID | 101323668 |
| Molecular Formula | C22H17N4NaO6S2 |
| Molecular Weight | 520.52 g/mol |
| Exact Mass | 520.05 |
| IUPAC Name | sodium 7-amino-5-[[4-(phenylsulfamoyl)phenyl]diazenyl]-3-sulfonaphthalen-1-olate |
| SMILES | Nc1cc(/N=N/c2ccc(S(=O)(=O)Nc3ccccc3)cc2)c2cc(S(=O)(=O)O)cc([O-])c2c1.[Na+] |
| InChI | InChI=1S/C22H18N4O6S2.Na/c23-14-10-20-19(12-18(13-22(20)27)34(30,31)32)21(11-14)25-24-15-6-8-17(9-7-15)33(28,29)26-16-4-2-1-3-5-16;/h1-13,26-27H,23H2,(H,30,31,32);/q;+1/p-1/b25-24+; |
| InChIKey | CWZULSFHXGTPCL-QREUMGABSA-M |
| XLogP | 0.96 |
| TPSA | 174.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.52 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|