C27H19N5O8S2 — CID 170961674
4-[[4-[(4-amino-6-sulfonaphthalen-1-yl)diazenyl]-6-sulfonaphthalen-1-yl]diazenyl]benzoic acid (PubChem CID 170961674) has the molecular formula C27H19N5O8S2 and a molecular weight of 605.61 g/mol. Its IUPAC name is 4-[[4-[(4-amino-6-sulfonaphthalen-1-yl)diazenyl]-6-sulfonaphthalen-1-yl]diazenyl]benzoic acid.
| Compound Name | 4-[[4-[(4-amino-6-sulfonaphthalen-1-yl)diazenyl]-6-sulfonaphthalen-1-yl]diazenyl]benzoic acid |
|---|---|
| PubChem CID | 170961674 |
| Molecular Formula | C27H19N5O8S2 |
| Molecular Weight | 605.61 g/mol |
| Exact Mass | 605.07 |
| IUPAC Name | 4-[[4-[(4-amino-6-sulfonaphthalen-1-yl)diazenyl]-6-sulfonaphthalen-1-yl]diazenyl]benzoic acid |
| SMILES | Nc1ccc(/N=N/c2ccc(/N=N/c3ccc(C(=O)O)cc3)c3ccc(S(=O)(=O)O)cc23)c2ccc(S(=O)(=O)O)cc12 |
| InChI | InChI=1S/C27H19N5O8S2/c28-23-9-10-24(19-7-5-17(13-21(19)23)41(35,36)37)31-32-26-12-11-25(20-8-6-18(14-22(20)26)42(38,39)40)30-29-16-3-1-15(2-4-16)27(33)34/h1-14H,28H2,(H,33,34)(H,35,36,37)(H,38,39,40)/b30-29+,32-31+ |
| InChIKey | IGRUBUAPDVQWRO-PNBBGTCESA-N |
| XLogP | 6.60 |
| TPSA | 221.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.61 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|