C20H15N3NaO3S — CID 170845569
CID 170845569 (PubChem CID 170845569) has the molecular formula C20H15N3NaO3S and a molecular weight of 400.42 g/mol.
| Compound Name | CID 170845569 |
|---|---|
| PubChem CID | 170845569 |
| Molecular Formula | C20H15N3NaO3S |
| Molecular Weight | 400.42 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | — |
| SMILES | Nc1ccc(/N=N/c2cccc3ccccc23)c2ccc(S(=O)(=O)O)cc12.[Na] |
| InChI | InChI=1S/C20H15N3O3S.Na/c21-18-10-11-20(16-9-8-14(12-17(16)18)27(24,25)26)23-22-19-7-3-5-13-4-1-2-6-15(13)19;/h1-12H,21H2,(H,24,25,26);/b23-22+; |
| InChIKey | WHQNNWNYBOJGSE-PGCQSHBKSA-N |
| XLogP | 4.86 |
| TPSA | 105.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.42 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|