C20H14N2O4S — CID 4189423
8-[(4-hydroxynaphthalen-1-yl)diazenyl]naphthalene-2-sulfonic acid (PubChem CID 4189423) has the molecular formula C20H14N2O4S and a molecular weight of 378.41 g/mol. Its IUPAC name is 8-[(4-hydroxynaphthalen-1-yl)diazenyl]naphthalene-2-sulfonic acid.
| Compound Name | 8-[(4-hydroxynaphthalen-1-yl)diazenyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 4189423 |
| Molecular Formula | C20H14N2O4S |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | 8-[(4-hydroxynaphthalen-1-yl)diazenyl]naphthalene-2-sulfonic acid |
| SMILES | O=S(=O)(O)c1ccc2cccc(/N=N/c3ccc(O)c4ccccc34)c2c1 |
| InChI | InChI=1S/C20H14N2O4S/c23-20-11-10-19(15-5-1-2-6-16(15)20)22-21-18-7-3-4-13-8-9-14(12-17(13)18)27(24,25)26/h1-12,23H,(H,24,25,26)/b22-21+ |
| InChIKey | BSCYICKDCDCJEG-QURGRASLSA-N |
| XLogP | 5.36 |
| TPSA | 99.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|