C12H10N2O5S — CID 135672570
4-hydroxy-3-[(2-hydroxyphenyl)diazenyl]benzenesulfonic acid (PubChem CID 135672570) has the molecular formula C12H10N2O5S and a molecular weight of 294.29 g/mol. Its IUPAC name is 4-hydroxy-3-[(2-hydroxyphenyl)diazenyl]benzenesulfonic acid.
| Compound Name | 4-hydroxy-3-[(2-hydroxyphenyl)diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 135672570 |
| Molecular Formula | C12H10N2O5S |
| Molecular Weight | 294.29 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | 4-hydroxy-3-[(2-hydroxyphenyl)diazenyl]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(O)c(/N=N/c2ccccc2O)c1 |
| InChI | InChI=1S/C12H10N2O5S/c15-11-4-2-1-3-9(11)13-14-10-7-8(20(17,18)19)5-6-12(10)16/h1-7,15-16H,(H,17,18,19)/b14-13+ |
| InChIKey | JHKMUZGOOZJVFW-BUHFOSPRSA-N |
| XLogP | 2.76 |
| TPSA | 119.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.29 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|