C13H11N3O6S — CID 137181497
3-[(2-amino-5-sulfophenyl)diazenyl]-4-hydroxybenzoic acid (PubChem CID 137181497) has the molecular formula C13H11N3O6S and a molecular weight of 337.31 g/mol. Its IUPAC name is 3-[(2-amino-5-sulfophenyl)diazenyl]-4-hydroxybenzoic acid.
| Compound Name | 3-[(2-amino-5-sulfophenyl)diazenyl]-4-hydroxybenzoic acid |
|---|---|
| PubChem CID | 137181497 |
| Molecular Formula | C13H11N3O6S |
| Molecular Weight | 337.31 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | 3-[(2-amino-5-sulfophenyl)diazenyl]-4-hydroxybenzoic acid |
| SMILES | Nc1ccc(S(=O)(=O)O)cc1/N=N/c1cc(C(=O)O)ccc1O |
| InChI | InChI=1S/C13H11N3O6S/c14-9-3-2-8(23(20,21)22)6-10(9)15-16-11-5-7(13(18)19)1-4-12(11)17/h1-6,17H,14H2,(H,18,19)(H,20,21,22)/b16-15+ |
| InChIKey | VBCNLCSELAEQFS-FOCLMDBBSA-N |
| XLogP | 2.33 |
| TPSA | 162.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|