C13H9F3N2O4S — CID 136865561
4-hydroxy-3-[[2-(trifluoromethyl)phenyl]diazenyl]benzenesulfonic acid (PubChem CID 136865561) has the molecular formula C13H9F3N2O4S and a molecular weight of 346.29 g/mol. Its IUPAC name is 4-hydroxy-3-[[2-(trifluoromethyl)phenyl]diazenyl]benzenesulfonic acid.
| Compound Name | 4-hydroxy-3-[[2-(trifluoromethyl)phenyl]diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 136865561 |
| Molecular Formula | C13H9F3N2O4S |
| Molecular Weight | 346.29 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | 4-hydroxy-3-[[2-(trifluoromethyl)phenyl]diazenyl]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(O)c(/N=N/c2ccccc2C(F)(F)F)c1 |
| InChI | InChI=1S/C13H9F3N2O4S/c14-13(15,16)9-3-1-2-4-10(9)17-18-11-7-8(23(20,21)22)5-6-12(11)19/h1-7,19H,(H,20,21,22)/b18-17+ |
| InChIKey | VTJQKDGLYKMOBR-ISLYRVAYSA-N |
| XLogP | 4.07 |
| TPSA | 99.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.29 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|