C17H12F3N3O4S — CID 136857512
6-amino-4-hydroxy-5-[[2-(trifluoromethyl)phenyl]diazenyl]naphthalene-1-sulfonic acid (PubChem CID 136857512) has the molecular formula C17H12F3N3O4S and a molecular weight of 411.36 g/mol. Its IUPAC name is 6-amino-4-hydroxy-5-[[2-(trifluoromethyl)phenyl]diazenyl]naphthalene-1-sulfonic acid.
| Compound Name | 6-amino-4-hydroxy-5-[[2-(trifluoromethyl)phenyl]diazenyl]naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 136857512 |
| Molecular Formula | C17H12F3N3O4S |
| Molecular Weight | 411.36 g/mol |
| Exact Mass | 411.05 |
| IUPAC Name | 6-amino-4-hydroxy-5-[[2-(trifluoromethyl)phenyl]diazenyl]naphthalene-1-sulfonic acid |
| SMILES | Nc1ccc2c(S(=O)(=O)O)ccc(O)c2c1/N=N/c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C17H12F3N3O4S/c18-17(19,20)10-3-1-2-4-12(10)22-23-16-11(21)6-5-9-14(28(25,26)27)8-7-13(24)15(9)16/h1-8,24H,21H2,(H,25,26,27)/b23-22+ |
| InChIKey | YLPXQIOBXWHKAI-GHVJWSGMSA-N |
| XLogP | 4.81 |
| TPSA | 125.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.36 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|