C17H11F3IN3O7S2 — CID 136502386
5-amino-4-hydroxy-3-[[4-iodo-2-(trifluoromethyl)phenyl]diazenyl]naphthalene-2,7-disulfonic acid (PubChem CID 136502386) has the molecular formula C17H11F3IN3O7S2 and a molecular weight of 617.32 g/mol. Its IUPAC name is 5-amino-4-hydroxy-3-[[4-iodo-2-(trifluoromethyl)phenyl]diazenyl]naphthalene-2,7-disulfonic acid.
| Compound Name | 5-amino-4-hydroxy-3-[[4-iodo-2-(trifluoromethyl)phenyl]diazenyl]naphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 136502386 |
| Molecular Formula | C17H11F3IN3O7S2 |
| Molecular Weight | 617.32 g/mol |
| Exact Mass | 616.90 |
| IUPAC Name | 5-amino-4-hydroxy-3-[[4-iodo-2-(trifluoromethyl)phenyl]diazenyl]naphthalene-2,7-disulfonic acid |
| SMILES | Nc1cc(S(=O)(=O)O)cc2cc(S(=O)(=O)O)c(/N=N/c3ccc(I)cc3C(F)(F)F)c(O)c12 |
| InChI | InChI=1S/C17H11F3IN3O7S2/c18-17(19,20)10-5-8(21)1-2-12(10)23-24-15-13(33(29,30)31)4-7-3-9(32(26,27)28)6-11(22)14(7)16(15)25/h1-6,25H,22H2,(H,26,27,28)(H,29,30,31)/b24-23+ |
| InChIKey | KGEKCKNHQKQRPD-WCWDXBQESA-N |
| XLogP | 4.66 |
| TPSA | 179.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.32 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|