C16H12N4Na2O10S2 — CID 137180826
CID 137180826 (PubChem CID 137180826) has the molecular formula C16H12N4Na2O10S2 and a molecular weight of 530.40 g/mol.
| Compound Name | CID 137180826 |
|---|---|
| PubChem CID | 137180826 |
| Molecular Formula | C16H12N4Na2O10S2 |
| Molecular Weight | 530.40 g/mol |
| Exact Mass | 529.98 |
| IUPAC Name | — |
| SMILES | Nc1cc(S(=O)(=O)O)cc2cc(S(=O)(=O)O)c(/N=N/c3ccc([N+](=O)[O-])cc3O)c(O)c12.[Na].[Na] |
| InChI | InChI=1S/C16H12N4O10S2.2Na/c17-10-6-9(31(25,26)27)3-7-4-13(32(28,29)30)15(16(22)14(7)10)19-18-11-2-1-8(20(23)24)5-12(11)21;;/h1-6,21-22H,17H2,(H,25,26,27)(H,28,29,30);;/b19-18+;; |
| InChIKey | MABHKWSNRAQORT-BUFQOAPZSA-N |
| XLogP | 1.89 |
| TPSA | 243.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.40 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|