C16H12N4NaO10S2+ — CID 135430936
sodium 4-amino-5-hydroxy-3-[(2-hydroxy-4-nitrophenyl)diazenyl]naphthalene-2,7-disulfonic acid (PubChem CID 135430936) has the molecular formula C16H12N4NaO10S2+ and a molecular weight of 507.41 g/mol. Its IUPAC name is sodium 4-amino-5-hydroxy-3-[(2-hydroxy-4-nitrophenyl)diazenyl]naphthalene-2,7-disulfonic acid.
| Compound Name | sodium 4-amino-5-hydroxy-3-[(2-hydroxy-4-nitrophenyl)diazenyl]naphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 135430936 |
| Molecular Formula | C16H12N4NaO10S2+ |
| Molecular Weight | 507.41 g/mol |
| Exact Mass | 506.99 |
| IUPAC Name | sodium 4-amino-5-hydroxy-3-[(2-hydroxy-4-nitrophenyl)diazenyl]naphthalene-2,7-disulfonic acid |
| SMILES | Nc1c(/N=N/c2ccc([N+](=O)[O-])cc2O)c(S(=O)(=O)O)cc2cc(S(=O)(=O)O)cc(O)c12.[Na+] |
| InChI | InChI=1S/C16H12N4O10S2.Na/c17-15-14-7(3-9(6-12(14)22)31(25,26)27)4-13(32(28,29)30)16(15)19-18-10-2-1-8(20(23)24)5-11(10)21;/h1-6,21-22H,17H2,(H,25,26,27)(H,28,29,30);/q;+1/b19-18+; |
| InChIKey | UHNZMUUWBNGSBW-LTRPLHCISA-N |
| XLogP | -0.35 |
| TPSA | 243.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.41 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|