C28H22N8O11S3 — CID 135853970
4-amino-3-[[4-[(4-amino-2-hydroxyphenyl)diazenyl]phenyl]diazenyl]-5-hydroxy-6-[(4-sulfophenyl)diazenyl]naphthalene-2,7-disulfonic acid (PubChem CID 135853970) has the molecular formula C28H22N8O11S3 and a molecular weight of 742.73 g/mol. Its IUPAC name is 4-amino-3-[[4-[(4-amino-2-hydroxyphenyl)diazenyl]phenyl]diazenyl]-5-hydroxy-6-[(4-sulfophenyl)diazenyl]naphthalene-2,7-disulfonic acid.
| Compound Name | 4-amino-3-[[4-[(4-amino-2-hydroxyphenyl)diazenyl]phenyl]diazenyl]-5-hydroxy-6-[(4-sulfophenyl)diazenyl]naphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 135853970 |
| Molecular Formula | C28H22N8O11S3 |
| Molecular Weight | 742.73 g/mol |
| Exact Mass | 742.06 |
| IUPAC Name | 4-amino-3-[[4-[(4-amino-2-hydroxyphenyl)diazenyl]phenyl]diazenyl]-5-hydroxy-6-[(4-sulfophenyl)diazenyl]naphthalene-2,7-disulfonic acid |
| SMILES | Nc1ccc(/N=N/c2ccc(/N=N/c3c(S(=O)(=O)O)cc4cc(S(=O)(=O)O)c(/N=N/c5ccc(S(=O)(=O)O)cc5)c(O)c4c3N)cc2)c(O)c1 |
| InChI | InChI=1S/C28H22N8O11S3/c29-15-1-10-20(21(37)13-15)34-31-16-2-4-17(5-3-16)32-35-26-22(49(42,43)44)11-14-12-23(50(45,46)47)27(28(38)24(14)25(26)30)36-33-18-6-8-19(9-7-18)48(39,40)41/h1-13,37-38H,29-30H2,(H,39,40,41)(H,42,43,44)(H,45,46,47)/b34-31+,35-32+,36-33+ |
| InChIKey | DUAVAWDTTLCFDA-JCLOTSFOSA-N |
| XLogP | 6.40 |
| TPSA | 329.77 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.73 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|