C34H29N13O13S4 — CID 135848712
4-amino-3,6-bis[[4-[(2,4-diamino-5-sulfophenyl)diazenyl]phenyl]diazenyl]-5-hydroxynaphthalene-2,7-disulfonic acid (PubChem CID 135848712) has the molecular formula C34H29N13O13S4 and a molecular weight of 955.95 g/mol. Its IUPAC name is 4-amino-3,6-bis[[4-[(2,4-diamino-5-sulfophenyl)diazenyl]phenyl]diazenyl]-5-hydroxynaphthalene-2,7-disulfonic acid.
| Compound Name | 4-amino-3,6-bis[[4-[(2,4-diamino-5-sulfophenyl)diazenyl]phenyl]diazenyl]-5-hydroxynaphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 135848712 |
| Molecular Formula | C34H29N13O13S4 |
| Molecular Weight | 955.95 g/mol |
| Exact Mass | 955.09 |
| IUPAC Name | 4-amino-3,6-bis[[4-[(2,4-diamino-5-sulfophenyl)diazenyl]phenyl]diazenyl]-5-hydroxynaphthalene-2,7-disulfonic acid |
| SMILES | Nc1cc(N)c(S(=O)(=O)O)cc1/N=N/c1ccc(/N=N/c2c(S(=O)(=O)O)cc3cc(S(=O)(=O)O)c(/N=N/c4ccc(/N=N/c5cc(S(=O)(=O)O)c(N)cc5N)cc4)c(O)c3c2N)cc1 |
| InChI | InChI=1S/C34H29N13O13S4/c35-20-11-22(37)26(61(49,50)51)13-24(20)44-40-16-1-5-18(6-2-16)42-46-32-28(63(55,56)57)9-15-10-29(64(58,59)60)33(34(48)30(15)31(32)39)47-43-19-7-3-17(4-8-19)41-45-25-14-27(62(52,53)54)23(38)12-21(25)36/h1-14,48H,35-39H2,(H,49,50,51)(H,52,53,54)(H,55,56,57)(H,58,59,60)/b44-40+,45-41+,46-42+,47-43+ |
| InChIKey | FXXFIMKBSJLZJX-SSBBCRENSA-N |
| XLogP | 7.10 |
| TPSA | 466.69 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 22 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 64 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 955.95 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 22 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|