C35H29N9Na2O7S2 — CID 137221161
CID 137221161 (PubChem CID 137221161) has the molecular formula C35H29N9Na2O7S2 and a molecular weight of 797.79 g/mol.
| Compound Name | CID 137221161 |
|---|---|
| PubChem CID | 137221161 |
| Molecular Formula | C35H29N9Na2O7S2 |
| Molecular Weight | 797.79 g/mol |
| Exact Mass | 797.14 |
| IUPAC Name | — |
| SMILES | Cc1cc(/N=N/c2ccc(-c3ccc(/N=N/c4c(S(=O)(=O)O)cc5cc(S(=O)(=O)O)c(/N=N/c6ccccc6)c(O)c5c4N)cc3)cc2)c(N)cc1N.[Na].[Na] |
| InChI | InChI=1S/C35H29N9O7S2.2Na/c1-19-15-28(27(37)18-26(19)36)42-39-24-11-7-20(8-12-24)21-9-13-25(14-10-21)41-43-33-29(52(46,47)48)16-22-17-30(53(49,50)51)34(35(45)31(22)32(33)38)44-40-23-5-3-2-4-6-23;;/h2-18,45H,36-38H2,1H3,(H,46,47,48)(H,49,50,51);;/b42-39+,43-41+,44-40+;; |
| InChIKey | LCXMJXVKXMSKLB-GLEUTNGMSA-N |
| XLogP | 8.25 |
| TPSA | 281.19 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 55 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.79 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|