C22H17N5O8S2 — CID 136934696
4-amino-5-hydroxy-3-[(4-hydroxyphenyl)diazenyl]-6-phenyldiazenylnaphthalene-2,7-disulfonic acid (PubChem CID 136934696) has the molecular formula C22H17N5O8S2 and a molecular weight of 543.54 g/mol. Its IUPAC name is 4-amino-5-hydroxy-3-[(4-hydroxyphenyl)diazenyl]-6-phenyldiazenylnaphthalene-2,7-disulfonic acid.
| Compound Name | 4-amino-5-hydroxy-3-[(4-hydroxyphenyl)diazenyl]-6-phenyldiazenylnaphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 136934696 |
| Molecular Formula | C22H17N5O8S2 |
| Molecular Weight | 543.54 g/mol |
| Exact Mass | 543.05 |
| IUPAC Name | 4-amino-5-hydroxy-3-[(4-hydroxyphenyl)diazenyl]-6-phenyldiazenylnaphthalene-2,7-disulfonic acid |
| SMILES | Nc1c(/N=N/c2ccc(O)cc2)c(S(=O)(=O)O)cc2cc(S(=O)(=O)O)c(/N=N/c3ccccc3)c(O)c12 |
| InChI | InChI=1S/C22H17N5O8S2/c23-19-18-12(10-16(36(30,31)32)20(19)26-25-14-6-8-15(28)9-7-14)11-17(37(33,34)35)21(22(18)29)27-24-13-4-2-1-3-5-13/h1-11,28-29H,23H2,(H,30,31,32)(H,33,34,35)/b26-25+,27-24+ |
| InChIKey | QKHSUQYHYRRIPG-BZHOXZENSA-N |
| XLogP | 5.16 |
| TPSA | 224.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.54 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|