C34H25N8O10S2- — CID 135801493
4-amino-5-hydroxy-3-[[4-[hydroxy(oxido)amino]phenyl]diazenyl]-6-[[4-[4-[(4-hydroxyphenyl)diazenyl]phenyl]phenyl]diazenyl]naphthalene-2,7-disulfonic acid (PubChem CID 135801493) has the molecular formula C34H25N8O10S2- and a molecular weight of 769.75 g/mol. Its IUPAC name is 4-amino-5-hydroxy-3-[[4-[hydroxy(oxido)amino]phenyl]diazenyl]-6-[[4-[4-[(4-hydroxyphenyl)diazenyl]phenyl]phenyl]diazenyl]naphthalene-2,7-disulfonic acid.
| Compound Name | 4-amino-5-hydroxy-3-[[4-[hydroxy(oxido)amino]phenyl]diazenyl]-6-[[4-[4-[(4-hydroxyphenyl)diazenyl]phenyl]phenyl]diazenyl]naphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 135801493 |
| Molecular Formula | C34H25N8O10S2- |
| Molecular Weight | 769.75 g/mol |
| Exact Mass | 769.11 |
| IUPAC Name | 4-amino-5-hydroxy-3-[[4-[hydroxy(oxido)amino]phenyl]diazenyl]-6-[[4-[4-[(4-hydroxyphenyl)diazenyl]phenyl]phenyl]diazenyl]naphthalene-2,7-disulfonic acid |
| SMILES | Nc1c(/N=N/c2ccc(N([O-])O)cc2)c(S(=O)(=O)O)cc2cc(S(=O)(=O)O)c(/N=N/c3ccc(-c4ccc(/N=N/c5ccc(O)cc5)cc4)cc3)c(O)c12 |
| InChI | InChI=1S/C34H25N8O10S2/c35-31-30-21(17-28(53(47,48)49)32(31)40-38-24-9-13-26(14-10-24)42(45)46)18-29(54(50,51)52)33(34(30)44)41-39-23-7-3-20(4-8-23)19-1-5-22(6-2-19)36-37-25-11-15-27(43)16-12-25/h1-18,43-45H,35H2,(H,47,48,49)(H,50,51,52)/q-1/b37-36+,40-38+,41-39+ |
| InChIKey | QJDYYWNEVGGMSF-ITEZJMJWSA-N |
| XLogP | 8.93 |
| TPSA | 295.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.75 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|